A2443112
S-(-)-Carbidopa , 98% , 28860-95-9
Synonym(s):
(S)-3-(3,4-Dihydroxyphenyl)-2-hydrazino-2-methylpropanoic acid;S-(−)-α-Hydrazino-3,4-dihydroxy-2-methylbenzenepropanoic acid
CAS NO.:28860-95-9
Empirical Formula: C10H14N2O4
Molecular Weight: 226.23
MDL number: MFCD00069231
EINECS: 657-445-4
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB399.20 | In Stock |
|
| 100MG | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205° (dec); mp 208° |
| alpha | D -17.3° (methanol) |
| Boiling point: | 367.84°C (rough estimate) |
| Density | 1.2616 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 3.40±0.14(Predicted) |
| color | White to Off-White |
| Stability: | Unstable in Solution |
| InChI | InChI=1/C10H14N2O4/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6/h2-4,12-14H,5,11H2,1H3,(H,15,16)/t10-/s3 |
| InChIKey | TZFNLOMSOLWIDK-JQHDBZEONA-N |
| SMILES | [C@@](C)(NN)(C(=O)O)CC1C=CC(O)=C(O)C=1 |&1:0,r| |
| CAS DataBase Reference | 28860-95-9(CAS DataBase Reference) |
Description and Uses
in combinaison with levodopa as antiparkinsonian;inhibits aromatic-L-amino-acid decarboxylase (DOPA Decarboxylase or DDC)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | MW5298000 |
| Storage Class | 11 - Combustible Solids |






