BD0381345
(R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylicacid , 97% , 193693-67-3
Synonym(s):
(R)-N-Fmoc-piperidine-3-carboxylic acid;(R)-Fmoc-nipecotic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB136.00 | In Stock |
|
| 1g | RMB464.80 | In Stock |
|
| 5g | RMB1799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 561.6±43.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 4.47±0.20(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | -44.1°(C=0.01g/mI, ETOH, 20°C, 589nm) |
| BRN | 7945846 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H21NO4/c23-20(24)14-6-5-11-22(12-14)21(25)26-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-4,7-10,14,19H,5-6,11-13H2,(H,23,24)/t14-/m1/s1 |
| InChIKey | FINXGQXNIBNREL-CQSZACIVSA-N |
| SMILES | OC(=O)[C@@H]1CCCN(C1)C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 193693-67-3(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
