BD0388532
(1S,3R)-3-Aminocyclopentanecarboxylic acid , 98% , 71830-07-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB939.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192 °C |
| Boiling point: | 239.22°C (rough estimate) |
| Density | 1.1426 (rough estimate) |
| refractive index | 1.4300 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| pka | 4.44±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | MLLSSTJTARJLHK-CRCLSJGQSA-N |
| SMILES | [C@H]1(C(O)=O)CC[C@@H](N)C1 |
| CAS DataBase Reference | 71830-07-4(CAS DataBase Reference) |
Description and Uses
(1S,3R)-
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26-22 |
| WGK Germany | WGK 3 |
| HS Code | 29299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




