BD0398732
N-(4-Fluoro-2-methoxy-5-nitrophenyl)-4-(1-methyl-1H-indol-3-yl)pyrimidin-2-amine , 95% , 1421372-94-2
CAS NO.:1421372-94-2
Empirical Formula: C20H16FN5O3
Molecular Weight: 393.37
MDL number: MFCD28167946
EINECS: 806-156-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB71.20 | In Stock |
|
| 1g | RMB178.40 | In Stock |
|
| 5g | RMB644.80 | In Stock |
|
| 25g | RMB1713.60 | In Stock |
|
| 100g | RMB5697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C (dec.) |
| Boiling point: | 639.3±65.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly, Heated) |
| pka | 2.02±0.10(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| InChI | InChI=1S/C20H16FN5O3/c1-25-11-13(12-5-3-4-6-17(12)25)15-7-8-22-20(23-15)24-16-10-18(26(27)28)14(21)9-19(16)29-2/h3-11H,1-2H3,(H,22,23,24) |
| InChIKey | SZTYQQYYIMVETL-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC([N+]([O-])=O)=C(F)C=C2OC)=NC=CC(C2C3=C(N(C)C=2)C=CC=C3)=N1 |
Description and Uses
N-(4-Fluoro-2-methoxy-5-nitrophenyl)-4-(1-methyl-1H-indol-3-yl)-2-pyrimidinamine functions as a reagent in the synthesis of dihydropyrroloquinoline derivatives with anticancer activity as EGFR modulator to inhibit L858R/T790M.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |





