BD8061331
N-(4-Chlorophenyl)-2-nitroaniline , 97% , 23008-56-2
CAS NO.:23008-56-2
Empirical Formula: C12H9ClN2O2
Molecular Weight: 248.67
MDL number: MFCD02683544
EINECS: 245-377-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB54.40 | In Stock |
|
| 1g | RMB133.60 | In Stock |
|
| 5g | RMB417.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C(lit.) |
| Boiling point: | 377.2±27.0 °C(Predicted) |
| Density | 1.387±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | -3.90±0.40(Predicted) |
| Appearance | Brown to dark brown Solid |
| InChI | InChI=1S/C12H9ClN2O2/c13-9-5-7-10(8-6-9)14-11-3-1-2-4-12(11)15(16)17/h1-8,14H |
| InChIKey | RCLKXSIRDRWUGX-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(Cl)C=C2)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 23008-56-2(CAS DataBase Reference) |
Description and Uses
2-Nitro-4''-chlorodiphenylamine is a reagent used in the synthesis of novel 4-phenoxyquinoline derivatives as c-Met kinase inhibitors. Intermediate for Clofazimine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2921490090 |






