BD8022931
N1-(4-Chlorophenyl)benzene-1,2-diamine , 97% , 68817-71-0
Synonym(s):
2-Amino-4′-chlorodiphenylamine
CAS NO.:68817-71-0
Empirical Formula: C12H11ClN2
Molecular Weight: 218.68
MDL number: MFCD00007686
EINECS: 272-391-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB52.80 | In Stock |
|
| 10g | RMB89.60 | In Stock |
|
| 25g | RMB207.20 | In Stock |
|
| 100g | RMB814.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 357.0±27.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.90±0.10(Predicted) |
| Appearance | Brown to reddish brown Solid |
| InChI | InChI=1S/C12H11ClN2/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8,15H,14H2 |
| InChIKey | WEUBIWJPIRTWDF-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(Cl)C=C2)=CC=CC=C1N |
Description and Uses
N-(4-Chlorophenyl)-1,2-phenylenediamine is a reagent in the synthesis of clofazimine analogs as antileishmanials and antiplasmodials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921599090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






