LN642585
2,4-Dinitrobenzenesulfonylchloride , 98% , 1656-44-6
CAS NO.:1656-44-6
Empirical Formula: C6H3ClN2O6S
Molecular Weight: 266.62
MDL number: MFCD00007431
EINECS: 216-749-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103 °C (lit.) |
| Boiling point: | 60-80 °C |
| Density | 1.780 |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Light Yellow Crystalline |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 2147583 |
| Stability: | Hygroscopic |
| InChI | 1S/C6H3ClN2O6S/c7-16(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| InChIKey | SSFSNKZUKDBPIT-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(c(c1)[N+]([O-])=O)S(Cl)(=O)=O |
| CAS DataBase Reference | 1656-44-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,4-dinitro- (1656-44-6) |
Description and Uses
2,4-Dinitrobenzenesulfonyl chloride was used to protect primary amines. It was used as starting reagent in the synthesis of tert-butyl 2-[(2,4-dinitrophenyl) sulfonyl]amino acetate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H340-H350-H373 |
| Precautionary statements | P202-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Blood |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,C |
| Risk Statements | 34-65-48/23/24/25-46-45-48/20/21/22 |
| Safety Statements | 53-26-36/37/39-45-62 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1A Eye Dam. 1 Muta. 1B Skin Corr. 1B STOT RE 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








