A3447212
2,4-Dinitrophenylsulfenyl Chloride , >96.0%(T) , 528-76-7
Synonym(s):
2,4-Dinitrophenylsulfenyl chloride;Kharasch reagent
CAS NO.:528-76-7
Empirical Formula: C6H3ClN2O4S
Molecular Weight: 234.62
MDL number: MFCD00007129
EINECS: 208-441-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-97 °C(lit.) |
| Boiling point: | 430.1±35.0 °C(Predicted) |
| Density | 1.700 (estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | benzene: soluble |
| form | solid |
| color | Light orange to Yellow to Green |
| Merck | 14,3274 |
| BRN | 405600 |
| InChI | 1S/C6H3ClN2O4S/c7-14-6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| InChIKey | GPXDNWQSQHFKRB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(SCl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 528-76-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfenyl chloride, 2,4-dinitro- (528-76-7) |
Description and Uses
2,4-Dinitrobenzenesulfenyl chloride was used in preparation of chlorine and bromine biphenyls.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H228-H302+H312+H332 |
| Precautionary statements | P280-P305+P351+P338-P310-P210-P240-P241-P260-P264-P270-P271-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 8-9-19-21 |
| TSCA | TSCA listed |
| HS Code | 2930.90.2900 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |








![2-Nitrophenylsulfenyl Chloride [<i>N</i>-Protecting Agent for Peptides Research]](https://img.chemicalbook.com/CAS/GIF/7669-54-7.gif)
