BD0404732
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid , 97% , 754214-42-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB69.60 | In Stock |
|
| 250mg | RMB106.40 | In Stock |
|
| 1g | RMB197.60 | In Stock |
|
| 5g | RMB682.40 | In Stock |
|
| 10g | RMB1325.60 | In Stock |
|
| 25g | RMB3088.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | SINFYKZXNIJIEU-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=CC(C(O)=O)=CN=2 |
Description and Uses
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid is used in pharmaceutical synthesis and experimental research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P302+P352 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |

![1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/754214-42-1.gif)

![3-Iodo-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid methyl ester](https://img.chemicalbook.com/CAS/GIF/944937-30-8.gif)
![6-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/872355-55-0.gif)
![METHYL 4-(4-FLUOROPHENYL)-6-ISOPROPYL-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBOXYLATE](https://img.chemicalbook.com/CAS/GIF/140640-91-1.gif)
![4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/920966-03-6.gif)