BD0417132
4-Bromoindoline , 97% , 86626-38-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB69.60 | In Stock |
|
| 1g | RMB267.20 | In Stock |
|
| 5g | RMB1054.40 | In Stock |
|
| 10g | RMB1918.40 | In Stock |
|
| 25g | RMB4120.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 278.8±29.0 °C(Predicted) |
| Density | 1.514±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 4.20±0.20(Predicted) |
| form | liquid |
| color | Brown to reddish brown |
| InChI | InChI=1S/C8H8BrN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-3,10H,4-5H2 |
| InChIKey | YCJCSDSXVHEBRU-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Br)=CC=C2)CC1 |
Description and Uses
4-Bromoindoline is a simple active pharmaceutical building block that can be used as a basic skeleton for the preparation of the migraine drug Sumatriptan.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| HS Code | 2933998090 |
