BD0417432
4-Amino-2-ethoxy-5-nitrobenzoic acid , 98% , 86718-18-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB114.40 | In Stock |
|
| 250mg | RMB194.40 | In Stock |
|
| 1g | RMB523.20 | In Stock |
|
| 5g | RMB1828.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >208°C (dec.) |
| Boiling point: | 461.8±45.0 °C(Predicted) |
| Density | 1.444±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.16±0.12(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C9H10N2O5/c1-2-16-8-4-6(10)7(11(14)15)3-5(8)9(12)13/h3-4H,2,10H2,1H3,(H,12,13) |
| InChIKey | VWEUQGXBVCSDPM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(N)C=C1OCC |
Description and Uses
4-Amino-2-ethoxy-5-nitrobenzoic Acid is a reactant used in the preparation Cinitapride (C441990).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P330-P363-P501 |
