PRODUCT Properties
| Melting point: | 270 °C |
| Boiling point: | 391.6±42.0 °C(Predicted) |
| Density | 1.153±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 11.13±0.70(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C11H11NO2/c1-7-5-11(13)12-10-4-3-8(14-2)6-9(7)10/h3-6H,1-2H3,(H,12,13) |
| InChIKey | VGQWDNJRHAWUNX-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C=C2)C(C)=CC1=O |
Description and Uses
6-Methoxy-4-methylcarbostyril is used in the synthesis of novel coumarin analogs which display nematicidal activity against five nematodes. Also used in the preparation of 4-methyl-2-oxo-1,2-dihydroquinolin-6-yl acetate which is an effective antiplatelet agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2933499090 |




