BD0425353
Tributyl(phenyl)stannane , 98% , 960-16-7
Synonym(s):
Phenyltributylstannane;Phenyltributyltin;Tributylphenyltin
| Pack Size | Price | Stock | Quantity |
| 5g | RMB148.80 | In Stock |
|
| 25g | RMB633.60 | In Stock |
|
| 100g | RMB2366.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 125-128 °C/0.14 mmHg (lit.) |
| Density | 1.125 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. -20°C |
| solubility | Sparingly Soluble (9.9E-5 g/L) (25°C) |
| form | Oil |
| color | Colourless to Light Yellow |
| Specific Gravity | 1.125 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3610571 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
Description and Uses
It is applied in chemical research.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |







