BD0431153
6-Methyl-1,2,4-triazine-3,5(2H,4H)-dione , 95% , 932-53-6
CAS NO.：932-53-6
Empirical Formula: C4H5N3O2
Molecular Weight: 127.1
MDL number: MFCD00006457
EINECS: 213-253-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB141.60 | In Stock |
|
| 1g | RMB354.40 | In Stock |
|
| 5g | RMB1152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 235.85°C (rough estimate) |
| Density | 1.4748 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| pka | 7.6(at 25℃) |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,903 |
| BRN | 126863 |
| InChI | InChI=1S/C4H5N3O2/c1-2-3(8)5-4(9)7-6-2/h1H3,(H2,5,7,8,9) |
| InChIKey | XZWMZFQOHTWGQE-UHFFFAOYSA-N |
| SMILES | N1=C(C)C(=O)NC(=O)N1 |
| CAS DataBase Reference | 932-53-6(CAS DataBase Reference) |
Description and Uses
6-Azathymine, a 6-nitrogen analog of thymine, is a potent D-3-aminoisobutyrate-pyruvate aminotransferase inhibitor. 6-Azathymine inhibits the biosynthesis of DNA, and has antibacterial and antiviral activities[1][2][3][4].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H302-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Safety Statements | 22-24/25 |
| RTECS | XY8050000 |
| HS Code | 2934.10.9000 |
| HazardClass | IRRITANT |
