BD0433445
                    cis-Methyl4-hydroxycyclohexanecarboxylate , 98% , 3618-03-9
| Pack Size | Price | Stock | Quantity | 
| 250mg | RMB44.80 | In Stock | 
                                                 | 
                                        
| 1g | RMB120.00 | In Stock | 
                                                 | 
                                        
| 5g | RMB585.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB2824.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 233.3±33.0℃ (760 Torr) | 
                                    
| Density | 1.121±0.06 g/cm3 (20 ºC 760 Torr) | 
                                    
| refractive index | 1.4705 (589.3 nm 21.5℃) | 
                                    
| Flash point: | 93.5±18.2℃ | 
                                    
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
                                    
| pka | 14.96±0.40(Predicted) | 
                                    
| Appearance | yellow oil | 
                                    
| InChI | InChI=1S/C8H14O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6-7,9H,2-5H2,1H3/t6-,7+ | 
                                    
| InChIKey | HYDYVXROZHFTGB-KNVOCYPGSA-N | 
                                    
| SMILES | [C@@H]1(C(OC)=O)CC[C@H](O)CC1 | 
                                    
Description and Uses
Methyl 4-hydroxycyclohexylcarboxylate is a carboxylate derivative and can be used as an organic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P264-P270-P301+P312-P330 | 
| HS Code | 2918199890 | 







