BD0437148
2,4,5-Trihydroxybenzaldehyde , 98% , 35094-87-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB436.80 | In Stock |
|
| 5g | RMB1684.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225 °C (lit.) |
| Boiling point: | 237.46°C (rough estimate) |
| Density | 1.3725 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 7.41±0.23(Predicted) |
| form | Crystalline Powder |
| color | Yellow to brown or khaki |
| Sensitive | Air Sensitive |
| BRN | 2250084 |
| InChI | InChI=1S/C7H6O4/c8-3-4-1-6(10)7(11)2-5(4)9/h1-3,9-11H |
| InChIKey | WNCNWLVQSHZVKV-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=C(O)C=C1O |
| CAS DataBase Reference | 35094-87-2(CAS DataBase Reference) |
Description and Uses
2,4,5-Trihydroxybenzaldehyde may be used in the synthesis of:
- 2,4,5-tribenzyloxybenzaldehyde
- 2,4,5-trihydroxybenzaldehyde N-(diphenylmethylene)hydrazine
- 2-hydroxy-4,5-dimethoxybenzaldehyde
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29124990 |
