PRODUCT Properties
| Melting point: | 75.5-76.5 °C (lit.) |
| Boiling point: | 222-223 °C (lit.) |
| Density | 1.3846 (rough estimate) |
| refractive index | 1.4340 (estimate) |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 12.15±0.46(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7) |
| InChIKey | ZSBDPRIWBYHIAF-UHFFFAOYSA-N |
| SMILES | C(NC(C)=O)(=O)C |
| CAS DataBase Reference | 625-77-4(CAS DataBase Reference) |
Description and Uses
N-Acetyl Acetamide is a useful reagent for organic synthesis.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






