BD0467845
Phenyl(2-(trifluoromethyl)phenyl)methanone , 98% , 727-99-1
CAS NO.:727-99-1
Empirical Formula: C14H9F3O
Molecular Weight: 250.22
MDL number: MFCD00000377
EINECS: 211-972-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB88.00 | In Stock |
|
| 5g | RMB159.20 | In Stock |
|
| 10g | RMB310.40 | In Stock |
|
| 25g | RMB660.80 | In Stock |
|
| 100g | RMB2524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C |
| Boiling point: | 175-178 °C(Press: 31 Torr) |
| Density | 1.2778 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | Off-white |
| BRN | 2375025 |
| InChI | 1S/C14H9F3O/c15-14(16,17)12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10/h1-9H |
| InChIKey | JXIWJBWMQXDALU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccccc1C(=O)c2ccccc2 |
| CAS DataBase Reference | 727-99-1(CAS DataBase Reference) |
Description and Uses
Assymmetric reduction of 2-(trifluoromethyl)benzophenone by lithium aluminium hydride treated with (S)-(+) or (R)-(−)-2 (2-iso-indolinyl)butan-1-ol has been investigated.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![2-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-2''-trifluorobenzophenone](https://img.chemicalbook.com/CAS/GIF/898756-27-9.gif)
![3''-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-2-trifluorobenzophenone](https://img.chemicalbook.com/CAS/GIF/898762-03-3.gif)

![4''-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-2-trifluoromethylbenzophenone](https://img.chemicalbook.com/CAS/GIF/898758-10-6.gif)