BD0481145
(2R,2R)-3,3-Disulfanediylbis(2-aminopropanoicacid)xhydrochloride , 98% , 34760-60-6
CAS NO.:34760-60-6
Empirical Formula: C6H13ClN2O4S2
Molecular Weight: 276.76
MDL number: MFCD00068399
EINECS: 252-196-4
| Pack Size | Price | Stock | Quantity |
| 10g | RMB24.00 | In Stock |
|
| 25g | RMB47.20 | In Stock |
|
| 100g | RMB166.40 | In Stock |
|
| 500g | RMB616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.520 g/cm3 |
| storage temp. | Inert atmosphere,2-8°C |
| form | liquid |
| color | colorless |
| BRN | 4828867 |
| Major Application | food and beverages |
| InChI | InChI=1/C6H12N2O4S2.ClH/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);1H/t3-,4-;/s3 |
| InChIKey | IOCJWNPYGRVHLN-QYDODFSFNA-N |
| SMILES | [C@@H](N)(C(=O)O)CSSC[C@H](N)C(=O)O.Cl |&1:0,9,r| |
| CAS DataBase Reference | 34760-60-6(CAS DataBase Reference) |
| EPA Substance Registry System | L-Cystine, hydrochloride (34760-60-6) |
Description and Uses
Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H411 |
| Precautionary statements | P260-P264-P273-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338+P310-P363-P405-P501 |
| PPE | Faceshields, Gloves, Goggles |
| RIDADR | UN 1789 8/PG 3 |
| WGK Germany | nwg |
| F | 10 |
| TSCA | TSCA listed |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Met. Corr. 1 |







