BD0487753
Ethylbenzoylformate , 95% , 1603-79-8
Synonym(s):
Ethyl phenylglyoxylate
CAS NO.：1603-79-8
Empirical Formula: C10H10O3
Molecular Weight: 178.18
MDL number: MFCD00009120
EINECS: 216-504-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB88.00 | In Stock |
|
| 25g | RMB352.00 | In Stock |
|
| 100g | RMB1060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 138-139 °C/18 mmHg (lit.) |
| Density | 1.122 g/mL at 25 °C (lit.) |
| refractive index | 1.515-1.517 |
| Flash point: | 113 °C |
| storage temp. | Store below +30°C. |
| form | Liquid |
| Specific Gravity | 1.122 |
| color | Clear colorless to greenish |
| Water Solubility | Soluble in water 1143 mg/L @ 25°C . |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H10O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | QKLCQKPAECHXCQ-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)C(=O)C(=O)OCC |
| LogP | 1.974 (est) |
| CAS DataBase Reference | 1603-79-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, «alpha»-oxo-, ethyl ester(1603-79-8) |
| EPA Substance Registry System | Benzeneacetic acid, .alpha.-oxo-, ethyl ester (1603-79-8) |
Description and Uses
Ethyl Benzoylformate is a general chemical reagent used in the preparation of diaminoethanediyl bismethylpyridinium salts for designing recyclable organocatalysts.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H227 |
| Precautionary statements | P501-P270-P210-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Moisture Sensitive |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
