BD0489748
4-(1,1,2,2-Tetrafluoroethoxy)benzoicacid , 98% , 10009-25-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB112.80 | In Stock |
|
| 5g | RMB336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-179 °C (lit.) |
| Boiling point: | 275.3±40.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.95±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | 1S/C9H6F4O3/c10-8(11)9(12,13)16-6-3-1-5(2-4-6)7(14)15/h1-4,8H,(H,14,15) |
| InChIKey | SVGWTILJZWYEMD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| CAS DataBase Reference | 10009-25-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |





