BD0497932
2-(Trifluoromethyl)-10H-phenothiazine , 98% , 92-30-8
CAS NO.:92-30-8
Empirical Formula: C13H8F3NS
Molecular Weight: 267.27
MDL number: MFCD00005018
EINECS: 202-145-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB41.60 | In Stock |
|
| 25g | RMB98.40 | In Stock |
|
| 100g | RMB367.20 | In Stock |
|
| 500g | RMB1617.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 361.1±42.0 °C(Predicted) |
| Density | 1.3491 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -2.60±0.20(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Green |
| BRN | 226580 |
| InChI | InChI=1S/C13H8F3NS/c14-13(15,16)8-5-6-12-10(7-8)17-9-3-1-2-4-11(9)18-12/h1-7,17H |
| InChIKey | RKGYJVASTMCSHZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC=C1C(F)(F)F |
| CAS DataBase Reference | 92-30-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 10H-phenothiazine, 2-(trifluoromethyl)-(92-30-8) |
| EPA Substance Registry System | 10H-Phenothiazine, 2-(trifluoromethyl)- (92-30-8) |
Description and Uses
2-(Trifluoromethyl)phenothiazine is used in the synthesis of antitubercolosis pharmaceuticals as well as antiproliferatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312a-P330-P501a-P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-22 |
| Safety Statements | 36-37/39-26 |
| WGK Germany | 3 |
| RTECS | SP5620000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29349990 |





