BD0508232
Harpagoside , 98% , 19210-12-9
CAS NO.:19210-12-9
Empirical Formula: C24H30O11
Molecular Weight: 494.49
MDL number: MFCD00017415
EINECS: 242-881-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB556.00 | In Stock |
|
| 100mg | RMB889.60 | In Stock |
|
| 250mg | RMB1512.00 | In Stock |
|
| 1g | RMB4082.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120°C (dec.) |
| Boiling point: | 720.7±60.0 °C(Predicted) |
| Density | 1.52±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 11.70±0.70(Predicted) |
| form | Solid |
| color | White to Light Yellow |
| optical activity | [α]/D -50 to -30° |
| Stability: | Hygroscopic |
| InChIKey | KVRQGMOSZKPBNS-FMHLWDFHSA-N |
| SMILES | O[C@@]12C=CO[C@@H](O[C@@]3([H])[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)[C@]1([H])[C@@](C)(OC(=O)/C=C/C1C=CC=CC=1)C[C@H]2O |&1:1,5,7,9,10,12,14,19,21,35,r| |
| LogP | -1.591 (est) |
| CAS DataBase Reference | 19210-12-9(CAS DataBase Reference) |
Description and Uses
Harpagoside is an iridoid glycoside along with with Harpagide (H105270), the potential to be strong anti-inflammatory agents providing the bulk of the observed effects from their plant origins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-45-24/25 |
| RIDADR | 3172 |
| WGK Germany | 3 |
| HS Code | 29389090 |




