![(1R,4R,5R)-4,7,7-Trimethyl-6-thiabicyclo[3.2.1]octane](https://img.chemicalbook.com/CAS/GIF/5718-75-2.gif)
BD0514348
(1R,4R,5R)-4,7,7-Trimethyl-6-thiabicyclo[3.2.1]octane , 95% , 5718-75-2
Synonym(s):
exo-(-)-4,7,7-Trimethyl-6-thiabicyclo[3.2.1]octane;Isothiocineole
CAS NO.：5718-75-2
Empirical Formula: C10H18S
Molecular Weight: 170.31
MDL number: MFCD08457822
EINECS: 227-219-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1233.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-90℃ (5 Torr) |
| Density | 0.941±0.06 g/cm3(Predicted) |
| refractive index | 1.5160 to 1.5200 |
| Flash point: | 87℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| JECFA Number | 1685 |
| InChI | 1S/C10H18S/c1-7-4-5-8-6-9(7)11-10(8,2)3/h7-9H,4-6H2,1-3H3/t7-,8+,9+/m0/s1 |
| InChIKey | FAXNZPOZWCWYBD-DJLDLDEBSA-N |
| SMILES | C[C@H]1CC[C@@H]2C[C@H]1SC2(C)C |
| LogP | 4.187 (est) |
| CAS DataBase Reference | 5718-75-2 |
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3082 - class 9 - PG 3 - DOT/IATA UN3334 - Environmentally hazardous substances, liquid, n.o.s., HI: all (not BR) |
| WGK Germany | 3 |
| HS Code | 2934.99.9001 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |
