BD0524845
Di-tert-butyloxalate , 95% , 691-64-5
CAS NO.：691-64-5
Empirical Formula: C10H18O4
Molecular Weight: 202.25
MDL number: MFCD00008806
EINECS: 211-723-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB40.00 | In Stock |
|
| 25g | RMB148.80 | In Stock |
|
| 100g | RMB516.80 | In Stock |
|
| 500g | RMB2194.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-72 °C (lit.) |
| Boiling point: | 229 °C |
| Density | 1.007±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| Appearance | White to off-white Solid |
| BRN | 1774415 |
| InChI | 1S/C10H18O4/c1-9(2,3)13-7(11)8(12)14-10(4,5)6/h1-6H3 |
| InChIKey | CIYGMWIAXRMHQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)OC(C)(C)C |
Description and Uses
Di-tert-butyl oxalate was used in preparation of disodium salt of 2-[(dihydroxyphosphinyl) difluoromethyl] propenoic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
