BD0528932
Methyl 2-nitroacetate , 96% , 2483-57-0
CAS NO.：2483-57-0
Empirical Formula: C3H5NO4
Molecular Weight: 119.08
MDL number: MFCD00075480
EINECS: 219-622-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5g | RMB132.00 | In Stock |
|
| 10g | RMB260.00 | In Stock |
|
| 25g | RMB552.00 | In Stock |
|
| 100g | RMB1956.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 195-198 °C (lit.) |
| Density | 1.294 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 221 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Miscible with ethanol, ether and most organic solvents. |
| pka | 5.73±0.29(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Light Sensitive |
| BRN | 1758670 |
| InChI | InChI=1S/C3H5NO4/c1-8-3(5)2-4(6)7/h2H2,1H3 |
| InChIKey | ALBSWLMUHHZLLR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C[N+]([O-])=O |
| CAS DataBase Reference | 2483-57-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, nitro-, methyl ester(2483-57-0) |
Description and Uses
Methyl nitroacetate is used in the synthesis of aromatic and heteroaromatic linear (E)-alfa-nitro-arylpentenoates. It is also used to prepare phenyliodonium ylide. Further, it is utilized in the highly enantioselective and diastereoselective copper(I)-catalyzed cyclopropanation of alkenes. In addition to this, it is employed in the production of methyl (Z)-2-nitro-3-(4-nitrophenyl)-2-propenoate through reaction with 4-nitrobenzylideneaniline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | AJ1093000 |
| F | 8 |
| HS Code | 29161995 |
