BD0551245
(Methanetetrayltetrakis(benzene-4,1-diyl))tetraboronicacid , 97% , 153035-55-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB319.20 | In Stock |
|
| 250mg | RMB592.80 | In Stock |
|
| 1g | RMB1603.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 791.6±70.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.79±0.16(Predicted) |
| form | solid |
| Appearance | White to light yellow Solid |
| InChI | 1S/C25H24B4O8/c30-26(31)21-9-1-17(2-10-21)25(18-3-11-22(12-4-18)27(32)33,19-5-13-23(14-6-19)28(34)35)20-7-15-24(16-8-20)29(36)37/h1-16,30-37H |
| InChIKey | LOMWOJPRCKKBIC-UHFFFAOYSA-N |
| SMILES | C(OB(C1=CC=C(B(O)O)C(B(O)O)=C1B(O)O)O)(OB(C1=CC=C(B(O)O)C(B(O)O)=C1B(O)O)O)(OB(C1=CC=C(B(O)O)C(B(O)O)=C1B(O)O)O)OB(C1=CC=C(B(O)O)C(B(O)O)=C1B(O)O)O |
Description and Uses
Used as a monomer for the synthesis of COF materials: COF-102; PAF-111/112/113; PPBI-1/2; MCOF-1.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |




![4',4''',4''''',4'''''''-Methanetetrayltetrakis(([1,1'-biphenyl]-4-carboxylicacid))](https://img.chemicalbook.com/CAS/20200401/GIF/1208241-38-6.gif)


![4-[tris(4-formylphenyl)methyl]benzaldehyde](https://img.chemicalbook.com/CAS/20180808/GIF/617706-61-3.gif)