BD9498655
4,4',4'',4'''-Methanetetrayltetrabenzoicacid , 95% , 160248-28-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB332.80 | In Stock |
|
| 250mg | RMB465.60 | In Stock |
|
| 1g | RMB1252.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 758.9±60.0 °C(Predicted) |
| Density | 1.434±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 3.45±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChIKey | VSFXBCHNPQPWBX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O |
Description and Uses
4,4',4'',4'''-Methanetetrayltetrabenzoic acid is used as a ligand in the synthesis of MOF materials, such as: MOF-812; MOF-841; MOF-36; SCU-11.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |





![4',4''',4''''',4'''''''-Methanetetrayltetrakis(([1,1'-biphenyl]-4-carboxylicacid))](https://img.chemicalbook.com/CAS/20200401/GIF/1208241-38-6.gif)

