BD0553932
7-Chloro-1-indanone , 98% , 34911-25-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB76.00 | In Stock |
|
| 250mg | RMB152.80 | In Stock |
|
| 1g | RMB318.40 | In Stock |
|
| 5g | RMB953.60 | In Stock |
|
| 10g | RMB1627.20 | In Stock |
|
| 25g | RMB3513.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98 °C |
| Boiling point: | 288.2±29.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C9H7ClO/c10-7-3-1-2-6-4-5-8(11)9(6)7/h1-3H,4-5H2 |
| InChIKey | YNFZQNGHYQYLCF-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2Cl)CC1 |
| CAS DataBase Reference | 34911-25-6(CAS DataBase Reference) |
Description and Uses
7-Chloro-1-indanone is a reagent used to synthesize tetracyclic quinoline and quinoxaline carboxamides which are used as therapeutic topoisomerase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2914390090 |
