![5,6-Dichloro-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide1,1-dioxide](https://img.chemicalbook.com/CAS/GIF/5233-42-1.gif)
BD0555153
5,6-Dichloro-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide1,1-dioxide , 97% , 5233-42-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB768.00 | In Stock |
|
| 250mg | RMB1305.60 | In Stock |
|
| 1g | RMB3524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293-295°C |
| Boiling point: | 601.9±65.0 °C(Predicted) |
| Density | 1.769±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly), Acetonitrile (Heated) |
| form | Solid |
| pka | 8.21±0.20(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C7H7Cl2N3O4S2/c8-5-3(17(10,13)14)1-4-7(6(5)9)11-2-12-18(4,15)16/h1,11-12H,2H2,(H2,10,13,14) |
| InChIKey | BSNKBIJVLZUERH-UHFFFAOYSA-N |
| SMILES | [S]1(=O)(=O)NCNc2c1cc(c(c2Cl)Cl)[S](=O)(=O)N |
Description and Uses
Hydrochlorothiazide derivative. Diuretic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2935909099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
