BD0566132
3-Chloro-4-iodoaniline , 98% , 135050-44-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB100.00 | In Stock |
|
| 5g | RMB189.60 | In Stock |
|
| 25g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-70 °C |
| Boiling point: | 312.8±27.0 °C(Predicted) |
| Density | 1.9011 (estimate) |
| Flash point: | 143℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Amber to Dark purple |
| Sensitive | Light Sensitive |
| BRN | 3236464 |
| InChI | InChI=1S/C6H5ClIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 |
| InChIKey | ONZHMGRKWJMTDE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(I)C(Cl)=C1 |
| CAS DataBase Reference | 135050-44-1(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-iodoaniline used as a intermediate for organic syntheses.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
