BD0574632
(S)-1-Boc-3-Isopropylpiperazine , 98% , 475272-54-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB304.80 | In Stock |
|
| 250mg | RMB509.60 | In Stock |
|
| 1g | RMB1021.60 | In Stock |
|
| 5g | RMB3095.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 298.4±15.0 °C(Predicted) |
| Density | 0.980±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 8.39±0.40(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C12H24N2O2/c1-9(2)10-8-14(7-6-13-10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | UHLAQCKNCBYTIF-SNVBAGLBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCN[C@@H](C(C)C)C1 |
Description and Uses
(S)-1-Boc-3-Isopropylpiperazine is used in the preparation of heteroaromatic derivatives as PDE4 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
