PRODUCT Properties
| Melting point: | 300-304 °C (lit.) |
| Boiling point: | 429.7±45.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| pka | 7.14±0.20(Predicted) |
| InChI | 1S/C11H7NO3/c1-6-8-3-2-7(13)4-10(8)15-11(14)9(6)5-12/h2-4,13H,1H3 |
| InChIKey | GLGBPOSQDAZSIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C#N)C(=O)Oc2cc(O)ccc12 |
Description and Uses
3-Cyano-7-hydroxy-4-methylcoumarin (CHMC) may be used as reagent for the stereo-specific preparation of RP- and SP-O-alkyl methylphosphonyl-CHMC esters.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
