BD0583432
(2S,3S)-2-((tert-Butoxycarbonyl)(methyl)amino)-3-methylpentanoic acid , 95% , 52498-32-5
Synonym(s):
Boc-N-methyl-L -isoleucine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB180.80 | In Stock |
|
| 5g | RMB548.00 | In Stock |
|
| 10g | RMB821.60 | In Stock |
|
| 25g | RMB1676.80 | In Stock |
|
| 100g | RMB4320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 338.2±21.0 °C(Predicted) |
| Density | 1.053±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | Solid |
| pka | 4.05±0.22(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 4251277 |
| InChI | InChI=1S/C12H23NO4/c1-7-8(2)9(10(14)15)13(6)11(16)17-12(3,4)5/h8-9H,7H2,1-6H3,(H,14,15)/t8-,9-/m0/s1 |
| InChIKey | HTBIAUMDQYXOFG-IUCAKERBSA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C)CC)N(C(OC(C)(C)C)=O)C |
| CAS DataBase Reference | 52498-32-5(CAS DataBase Reference) |
Description and Uses
Boc-N-methyl-L-isoleucine (Boc-N-Me-Ile-OH) is a peptide products and can be used as a precursor in organic synthesis and pharmaceuticals[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
