BD0585832
5-Bromo-6-methoxypyridin-3-amine , 98% , 53242-18-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB111.20 | In Stock |
|
| 10g | RMB188.80 | In Stock |
|
| 25g | RMB391.20 | In Stock |
|
| 100g | RMB1470.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 292.4±35.0 °C(Predicted) |
| Density | 1.622±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.10±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C6H7BrN2O/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,8H2,1H3 |
| InChIKey | YWYVVGOHQBANQI-UHFFFAOYSA-N |
| SMILES | C1=NC(OC)=C(Br)C=C1N |
| CAS DataBase Reference | 53242-18-5(CAS DataBase Reference) |
Description and Uses
5-Amino-3-bromo-2-methoxypyridine is a bromine-substituted methoxypyridine compound. The substitution of halogen and amino groups increases its reactivity. It is a versatile chemical compound with significant applications in pharmaceutical research and development.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
