BD0769232
5-Bromo-2-methoxy-4-methyl-3-nitropyridine , 97% , 884495-14-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB96.00 | In Stock |
|
| 10g | RMB185.60 | In Stock |
|
| 25g | RMB451.20 | In Stock |
|
| 100g | RMB1713.60 | In Stock |
|
| 500g | RMB7910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 302.8±37.0 °C(Predicted) |
| Density | 1.636±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate |
| pka | -2.34±0.28(Predicted) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C7H7BrN2O3/c1-4-5(8)3-9-7(13-2)6(4)10(11)12/h3H,1-2H3 |
| InChIKey | BGDKJBCVNNWITN-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C(Br)C(C)=C1[N+]([O-])=O |
Description and Uses
5-Bromo-2-methoxy-4-methyl-3-nitropyridine (BMN) is a chemical compound with anticancer activity. BMN inhibits tumor growth by binding to the bromodomain, which is found in many proteins that regulate cell division and DNA repair.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933399990 |







