BD0588353
Trichloropyridine , 97% , 29154-14-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB65.60 | In Stock |
|
| 25g | RMB190.40 | In Stock |
|
| 100g | RMB748.80 | In Stock |
|
| 500g | RMB2676.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-50 °C |
| Boiling point: | 85-98 °C(Press: 12 Torr) |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | GPAKJVMKNDXBHH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1Cl |
| CAS DataBase Reference | 29154-14-1(CAS DataBase Reference) |
Description and Uses
2,3,6-Trichloropyridine can be used as a catalyst for various compounds, such as, 2,3-dichloropyridine. This compound can also be used as an intermediate in chemosynthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H312-H302 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
