BD0598032
Boc-Pro-OMe , 97% , 59936-29-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB35.20 | In Stock |
|
| 25g | RMB64.00 | In Stock |
|
| 100g | RMB234.40 | In Stock |
|
| 500g | RMB1100.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135°C/16mmHg(lit.) |
| Density | 1.120±0.06 g/cm3(Predicted) |
| refractive index | 1.4510 to 1.4550 |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | -3.35±0.40(Predicted) |
| color | Colorless to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | WVDGSSCWFMSRHN-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@H]1C(OC)=O |
| CAS DataBase Reference | 59936-29-7(CAS DataBase Reference) |
Description and Uses
N-Boc-L-proline methyl ester is generally used as a intermediate in pharmaceutical and chemical research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| HS Code | 2933.99.9701 |
