BD0599748
5-Fluoroindoline , 95% , 2343-22-8
Synonym(s):
5-Fluoro-2,3-dihydro-1H-indole;5-Fluoro-2,3-dihydroindole
CAS NO.：2343-22-8
Empirical Formula: C8H8FN
Molecular Weight: 137.15
MDL number: MFCD00214461
EINECS: 607-884-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB129.60 | In Stock |
|
| 1g | RMB324.00 | In Stock |
|
| 5g | RMB1255.20 | In Stock |
|
| 25g | RMB4245.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118 °C |
| Boiling point: | 102-104°C 7mm |
| Density | 1.171 g/mL at 25 °C |
| refractive index | n/D1.556 |
| Flash point: | 107℃ |
| storage temp. | 2-8°C |
| form | oil |
| pka | 5.19±0.20(Predicted) |
| color | Colourless to light green or yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H8FN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2 |
| InChIKey | NXQRMQIYCWFDGP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(F)C=C2)CC1 |
Description and Uses
5-Fluoroindoline is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
