BD0606145
(4-Bromophenoxy)(tert-butyl)dimethylsilane , 95% , 67963-68-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.00 | In Stock |
|
| 5g | RMB197.60 | In Stock |
|
| 25g | RMB747.20 | In Stock |
|
| 100g | RMB2253.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 137 °C25 mm Hg(lit.) |
| Density | 1.174 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 53 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Ethyl Acetate, Methanol |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.175 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C12H19BrOSi/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9H,1-5H3 |
| InChIKey | DLGZGLKSNRKLSM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(O[Si](C(C)(C)C)(C)C)C=C1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36-37/39-60-37-23 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 3 |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




