BD0608953
Methylbut-3-enoate , 97% , 3724-55-8
Synonym(s):
Methyl vinylacetate
CAS NO.:3724-55-8
Empirical Formula: C5H8O2
Molecular Weight: 100.12
MDL number: MFCD00082587
EINECS: 223-076-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.00 | In Stock |
|
| 1g | RMB111.20 | In Stock |
|
| 5g | RMB508.00 | In Stock |
|
| 25g | RMB2030.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -78.42°C (estimate) |
| Boiling point: | 112 °C (lit.) |
| Density | 0.939 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 60 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1741732 |
| InChI | InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3H,1,4H2,2H3 |
| InChIKey | GITITJADGZYSRL-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CC=C |
| LogP | 0.839 (est) |
| NIST Chemistry Reference | Methyl 3-butenoate(3724-55-8) |
| EPA Substance Registry System | 3-Butenoic acid, methyl ester (3724-55-8) |
Description and Uses
Methyl 3-butenoate may be employed for the synthesis of dipeptide olefin isosteres using intermolecular olefin cross-metathesis.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.1 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







