BD0615045
2,2'-(Benzylazanediyl)diaceticacid , 98% , 3987-53-9
CAS NO.:3987-53-9
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00004285
EINECS: 223-631-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB328.80 | In Stock |
|
| 5g | RMB940.80 | In Stock |
|
| 25g | RMB3228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-202 °C (dec.)(lit.) |
| Boiling point: | 420.9±35.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | very faint turbidity in hot Water |
| form | powder to crystal |
| pka | 1.77±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C11H13NO4/c13-10(14)7-12(8-11(15)16)6-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,14)(H,15,16) |
| InChIKey | SZQUPQVVCLFZLC-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 3987-53-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2922.49.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





