PRODUCT Properties
| Boiling point: | 102-103 °C/50 mmHg (lit.) |
| Density | 0.964 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Dichloromethane (Sparingly), Ethanol (Slightly) |
| form | Oil |
| color | Colourless |
| Specific Gravity | 0.97 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8?,10?/m1/s1 |
| InChIKey | NQFUSWIGRKFAHK-BGPATTHWSA-N |
| SMILES | CC1(C)[C@H]2CC3OC3(C)[C@@H]1C2 |
| LogP | 2.339 (est) |
| CAS DataBase Reference | 1686-14-2(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Oxatricyclo[4.1.1.02,4]octane, 2,7,7-trimethyl- (1686-14-2) |
Description and Uses
An industrially important reaction of optically active a-pinene oxide is rearrangement to campholene aldehyde (e.g., in the presence of zinc bromide). Subsequent aldol condensation with lower aliphatic aldehydes or ketones (e.g., propionaldehyde, butyraldehyde, or acetone) provides unsaturated aldehydes or ketones that can be reduced to the corresponding saturated alcohols. These are used in the fragrance industry as a sandalwood scent.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H227-H331 |
| Precautionary statements | P210-P261-P271-P280-P304+P340+P311-P370+P378-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | TK4565000 |
| TSCA | TSCA listed |
| HS Code | 2910.90.9100 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |





