BD0621232
(S)-3-Amino-3-(3-nitrophenyl)propanoic acid , 97% , 734529-57-8
CAS NO.：734529-57-8
Empirical Formula: C9H10N2O4
Molecular Weight: 210.19
MDL number: MFCD04113693
EINECS: 200-528-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB114.40 | In Stock |
|
| 250mg | RMB196.80 | In Stock |
|
| 1g | RMB500.80 | In Stock |
|
| 5g | RMB1634.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 384.5±37.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.52±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| optical activity | Consistent with structure |
| Sensitive | Air Sensitive |
| InChI | InChI=1/C9H10N2O4/c10-8(5-9(12)13)6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/s3 |
| InChIKey | SJBFILRQMRECCK-SBYBRXNCNA-N |
| SMILES | [C@H](C1C=CC=C(N(=O)=O)C=1)(N)CC(=O)O |&1:0,r| |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2922498590 |
