BD0637945
(E)-Methyl2-(2-((6-chloropyrimidin-4-yl)oxy)phenyl)-3-methoxyacrylate , 97% , 131860-97-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5g | RMB56.00 | In Stock |
|
| 10g | RMB104.80 | In Stock |
|
| 25g | RMB209.60 | In Stock |
|
| 100g | RMB607.20 | In Stock |
|
| 500g | RMB1829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 469.3±45.0 °C(Predicted) |
| Density | 1.305 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | Solid |
| pka | -2.52±0.18(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C15H13ClN2O4/c1-20-8-11(15(19)21-2)10-5-3-4-6-12(10)22-14-7-13(16)17-9-18-14/h3-9H,1-2H3/b11-8+ |
| InChIKey | YRYZZSRRDCTETP-DHZHZOJOSA-N |
| SMILES | N1=C(Cl)C=C(OC2C(/C(/C(OC)=O)=C\OC)=CC=CC=2)N=C1 |
Description and Uses
(αE)-2-[(6-chloro-4-pyrimidinyl)oxy]-α-(methoxymethylene)benzeneacetic Acid Methyl Ester is an intermediate in the synthesis of Azoxystrobin (A965150), an strobilurin fungicide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P321-P333+P313 |
| HS Code | 2933599590 |
