BD0644153
N,N-Diethylbenzamide , 98% , 1696-17-9
CAS NO.：1696-17-9
Empirical Formula: C11H15NO
Molecular Weight: 177.24
MDL number: MFCD00026726
EINECS: 216-912-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB86.40 | In Stock |
|
| 25g | RMB292.80 | In Stock |
|
| 100g | RMB967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40°C |
| Boiling point: | 146-150°C 15mm |
| Density | 1.0290 (rough estimate) |
| refractive index | 1.5240 to 1.5280 |
| Flash point: | >100°C |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -1.14±0.70(Predicted) |
| form | clear liquid |
| color | White to Yellow to Green |
| BRN | 1909505 |
| InChI | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | JLNGEXDJAQASHD-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 1696-17-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, N,N-diethyl- (1696-17-9) |
Description and Uses
N,N-Diethylbenzamide is used as an insect repellent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RTECS | CV4202000 |
| TSCA | Yes |
| HS Code | 2924297099 |
| Toxicity | LD50 oral in rat: 2gm/kg |
