BD0647953
2-Nitrophenylisocyanate , 98% , 3320-86-3
CAS NO.:3320-86-3
Empirical Formula: C7H4N2O3
Molecular Weight: 164.12
MDL number: MFCD00007092
EINECS: 222-024-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB107.20 | In Stock |
|
| 5g | RMB369.60 | In Stock |
|
| 25g | RMB1251.20 | In Stock |
|
| 100g | RMB4276.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-41 °C(lit.) |
| Boiling point: | 135-137 °C17 mm Hg(lit.) |
| Density | 1.5018 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Crystalline Solid |
| color | Yellow |
| InChI | 1S/C7H4N2O3/c10-5-8-6-3-1-2-4-7(6)9(11)12/h1-4H |
| InChIKey | JRVZITODZAQRQM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccccc1N=C=O |
| CAS DataBase Reference | 3320-86-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1-isocyanato-2-nitro- (3320-86-3) |
Description and Uses
2-Nitrophenyl isocyanate was used in the synthesis of symmetrical bis-2-nitrophenylcarbodi-imide via dimerisation reaction.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | 2206 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29291090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







