BD0650232
3-(Furan-2-yl)propanoic acid , 98% , 935-13-7
Synonym(s):
2-Furanpropanoic acid;2-Furanpropionic acid
CAS NO.:935-13-7
Empirical Formula: C7H8O3
Molecular Weight: 140.14
MDL number: MFCD00005346
EINECS: 213-298-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB45.60 | In Stock |
|
| 1g | RMB100.00 | In Stock |
|
| 5g | RMB390.40 | In Stock |
|
| 25g | RMB1598.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-59 °C |
| Boiling point: | 229 |
| Density | 1.2127 (rough estimate) |
| refractive index | 1.4638 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | Crystalline Powder |
| pka | 4.51±0.10(Predicted) |
| color | Almost white to brown |
| InChI | InChI=1S/C7H8O3/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9) |
| InChIKey | XLTJXJJMUFDQEZ-UHFFFAOYSA-N |
| SMILES | O1C=CC=C1CCC(O)=O |
| CAS DataBase Reference | 935-13-7(CAS DataBase Reference) |
Description and Uses
3-(2-Furyl)propionic acid is a metabolite of furfural that can be found in the urine at physiological levels.
3-(2-Furyl)propionic acid can be used as an indicator for monitoring membrane integrity, as it will react with hippuric acid to form 3-(3-hydroxypropyl)furan-2-carboxylic acid, which can then be quantified using high performance liquid chromatography.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38 |
| Safety Statements | 37/39-26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








