S3755951
PESTANAL ,analyticalstandard , 117-52-2
Synonym(s):
3-(α-Acetonyl-2-furylmethyl)-4-hydroxycoumarin;3-(α-Acetonylfuryl)-4-hydroxy-coumarin
CAS NO.:117-52-2
Empirical Formula: C17H14O5
Molecular Weight: 298.29
MDL number: MFCD00128012
EINECS: 204-195-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124° |
| Boiling point: | 359.71°C (rough estimate) |
| Density | 1.2006 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Flash point: | >212 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.50±1.00(Predicted) |
| color | White |
| Merck | 13,2582 |
| BRN | 6817711 |
| Major Application | agriculture environmental |
| InChI | 1S/C17H14O5/c1-10(18)9-12(13-7-4-8-21-13)15-16(19)11-5-2-3-6-14(11)22-17(15)20/h2-8,12,19H,9H2,1H3 |
| InChIKey | JFIXKFSJCQNGEK-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccco1)C2=C(O)c3ccccc3OC2=O |
| EPA Substance Registry System | Coumafuryl (117-52-2) |
Description and Uses
Rodenticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H372-H412 |
| Precautionary statements | P260-P264-P270-P273-P301+P310-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-48/25-52/53 |
| Safety Statements | 37-45-61 |
| RIDADR | 3027 |
| WGK Germany | 3 |
| RTECS | GN4850000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Aquatic Chronic 3 STOT RE 1 Oral |
| Hazardous Substances Data | 117-52-2(Hazardous Substances Data) |
| Toxicity | LDLo orl-rat: 400 mg/kg 85GYAZ -,115,71 |







