BD0652645
Methyl2-(bromomethyl)-4-nitrobenzoate , 95% , 133446-99-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB136.00 | In Stock |
|
| 250mg | RMB237.60 | In Stock |
|
| 1g | RMB522.40 | In Stock |
|
| 5g | RMB1568.00 | In Stock |
|
| 25g | RMB6277.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 398.4±37.0 °C(Predicted) |
| Density | 1.624±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | Off-white |
| InChI | 1S/C9H8BrNO4/c1-15-9(12)8-3-2-7(11(13)14)4-6(8)5-10/h2-4H,5H2,1H3 |
| InChIKey | PGNKFDOPHHNVNF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1CBr)[N+]([O-])=O |
Description and Uses
Methyl 2-(Bromomethyl)-4-nitrobenzoate is used in the synthetic preparation of cyclic hydroxamic acid derivatives as histone deacetylase inhibitors with antitumor activity.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P260-P280-P301+P330+P331 |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 3 |
| HS Code | 2916310090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
